C22H19N — CID 146594518
N-(4-cyclohexa-1,5-dien-1-ylphenyl)naphthalen-2-amine (PubChem CID 146594518) has the molecular formula C22H19N and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(4-cyclohexa-1,5-dien-1-ylphenyl)naphthalen-2-amine.
| Compound Name | N-(4-cyclohexa-1,5-dien-1-ylphenyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 146594518 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(4-cyclohexa-1,5-dien-1-ylphenyl)naphthalen-2-amine |
| SMILES | C1=CC(c2ccc(Nc3ccc4ccccc4c3)cc2)=CCC1 |
| InChI | InChI=1S/C22H19N/c1-2-6-17(7-3-1)19-10-13-21(14-11-19)23-22-15-12-18-8-4-5-9-20(18)16-22/h2,4-16,23H,1,3H2 |
| InChIKey | FTBLNPXTROZHRC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |