C48H45N3 — CID 145186871
N'-(cyclohexa-1,5-dien-1-ylmethyl)-4-[11-[(2Z,4Z)-hepta-2,4,6-trienyl]benzo[a]fluoren-11-yl]-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide;ethane (PubChem CID 145186871) has the molecular formula C48H45N3 and a molecular weight of 663.91 g/mol. Its IUPAC name is N'-(cyclohexa-1,5-dien-1-ylmethyl)-4-[11-[(2Z,4Z)-hepta-2,4,6-trienyl]benzo[a]fluoren-11-yl]-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide;ethane.
| Compound Name | N'-(cyclohexa-1,5-dien-1-ylmethyl)-4-[11-[(2Z,4Z)-hepta-2,4,6-trienyl]benzo[a]fluoren-11-yl]-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 145186871 |
| Molecular Formula | C48H45N3 |
| Molecular Weight | 663.91 g/mol |
| Exact Mass | 663.36 |
| IUPAC Name | N'-(cyclohexa-1,5-dien-1-ylmethyl)-4-[11-[(2Z,4Z)-hepta-2,4,6-trienyl]benzo[a]fluoren-11-yl]-N-[(methylideneamino)-phenylmethylidene]benzenecarboximidamide;ethane |
| SMILES | C=C/C=C\C=C/CC1(c2ccc(C(/N=C(\N=C)c3ccccc3)=N/CC3=CCCC=C3)cc2)c2ccccc2-c2ccc3ccccc3c21.CC |
| InChI | InChI=1S/C46H39N3.C2H6/c1-3-4-5-6-17-32-46(42-25-16-15-24-40(42)41-31-28-35-20-13-14-23-39(35)43(41)46)38-29-26-37(27-30-38)45(48-33-34-18-9-7-10-19-34)49-44(47-2)36-21-11-8-12-22-36;1-2/h3-6,8-9,11-31H,1-2,7,10,32-33H2;1-2H3/b5-4-,17-6-,48-45-,49-44-; |
| InChIKey | YJOJJWBFFQMCBP-KVGHBOGQSA-N |
| XLogP | 12.04 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.91 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|