C49H46N2 — CID 145186850
ethane;(Z)-N-[(Z,2E)-2-ethylidenehex-3-enyl]-N'-methylidene-3-phenyl-1-[4-(11-phenylbenzo[a]fluoren-11-yl)phenyl]prop-2-ene-1,3-diimine (PubChem CID 145186850) has the molecular formula C49H46N2 and a molecular weight of 662.92 g/mol. Its IUPAC name is ethane;(Z)-N-[(Z,2E)-2-ethylidenehex-3-enyl]-N'-methylidene-3-phenyl-1-[4-(11-phenylbenzo[a]fluoren-11-yl)phenyl]prop-2-ene-1,3-diimine.
| Compound Name | ethane;(Z)-N-[(Z,2E)-2-ethylidenehex-3-enyl]-N'-methylidene-3-phenyl-1-[4-(11-phenylbenzo[a]fluoren-11-yl)phenyl]prop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 145186850 |
| Molecular Formula | C49H46N2 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | ethane;(Z)-N-[(Z,2E)-2-ethylidenehex-3-enyl]-N'-methylidene-3-phenyl-1-[4-(11-phenylbenzo[a]fluoren-11-yl)phenyl]prop-2-ene-1,3-diimine |
| SMILES | C=N/C(=C\C(=N/CC(/C=C\CC)=C/C)c1ccc(C2(c3ccccc3)c3ccccc3-c3ccc4ccccc4c32)cc1)c1ccccc1.CC |
| InChI | InChI=1S/C47H40N2.C2H6/c1-4-6-17-34(5-2)33-49-45(32-44(48-3)36-19-9-7-10-20-36)37-26-29-39(30-27-37)47(38-21-11-8-12-22-38)43-25-16-15-24-41(43)42-31-28-35-18-13-14-23-40(35)46(42)47;1-2/h5-32H,3-4,33H2,1-2H3;1-2H3/b17-6-,34-5+,44-32-,49-45+; |
| InChIKey | MPBSCYRZWNUNHN-VWZOQVIISA-N |
| XLogP | 12.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|