C50H42N2 — CID 145186864
N-[1-[4-[(5E)-5-[(Z)-but-2-enylidene]-6-methylidene-11-[(2Z)-penta-2,4-dienyl]benzo[a]fluoren-11-yl]phenyl]ethylidene]-N'-(1-phenylethenyl)benzenecarboximidamide (PubChem CID 145186864) has the molecular formula C50H42N2 and a molecular weight of 670.90 g/mol. Its IUPAC name is N-[1-[4-[(5E)-5-[(Z)-but-2-enylidene]-6-methylidene-11-[(2Z)-penta-2,4-dienyl]benzo[a]fluoren-11-yl]phenyl]ethylidene]-N'-(1-phenylethenyl)benzenecarboximidamide.
| Compound Name | N-[1-[4-[(5E)-5-[(Z)-but-2-enylidene]-6-methylidene-11-[(2Z)-penta-2,4-dienyl]benzo[a]fluoren-11-yl]phenyl]ethylidene]-N'-(1-phenylethenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 145186864 |
| Molecular Formula | C50H42N2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | N-[1-[4-[(5E)-5-[(Z)-but-2-enylidene]-6-methylidene-11-[(2Z)-penta-2,4-dienyl]benzo[a]fluoren-11-yl]phenyl]ethylidene]-N'-(1-phenylethenyl)benzenecarboximidamide |
| SMILES | C=C/C=C\CC1(c2ccc(/C(C)=N/C(=N/C(=C)c3ccccc3)c3ccccc3)cc2)c2ccccc2-c2c1c1ccccc1/c(=C/C=C\C)c2=C |
| InChI | InChI=1S/C50H42N2/c1-6-8-20-34-50(46-29-19-18-28-45(46)47-35(3)42(25-9-7-2)43-26-16-17-27-44(43)48(47)50)41-32-30-39(31-33-41)37(5)52-49(40-23-14-11-15-24-40)51-36(4)38-21-12-10-13-22-38/h6-33H,1,3-4,34H2,2,5H3/b9-7-,20-8-,42-25+,51-49+,52-37+ |
| InChIKey | PPHJNKJUTPXBGK-YPMDXNNLSA-N |
| XLogP | 10.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|