C50H37N3 — CID 144775630
3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-naphthalen-1-yl-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide (PubChem CID 144775630) has the molecular formula C50H37N3 and a molecular weight of 679.87 g/mol. Its IUPAC name is 3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-naphthalen-1-yl-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide.
| Compound Name | 3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-naphthalen-1-yl-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 144775630 |
| Molecular Formula | C50H37N3 |
| Molecular Weight | 679.87 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | 3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-naphthalen-1-yl-N'-[C-phenyl-N-(1-phenylethenyl)carbonimidoyl]benzenecarboximidamide |
| SMILES | C=Cc1c(C=C)c2cccc(-c3cc(/C(N)=N/C(=N/C(=C)c4ccccc4)c4ccccc4)cc(-c4cccc5ccccc45)c3)c2c2ccccc12 |
| InChI | InChI=1S/C50H37N3/c1-4-40-41(5-2)46-29-17-28-44(48(46)47-26-15-14-25-45(40)47)38-30-37(43-27-16-23-35-20-12-13-24-42(35)43)31-39(32-38)49(51)53-50(36-21-10-7-11-22-36)52-33(3)34-18-8-6-9-19-34/h4-32H,1-3H2,(H2,51,52,53) |
| InChIKey | MGMAINAMQAWEPG-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.87 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|