C54H36N4 — CID 144775685
4-[3-[3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]isoquinoline (PubChem CID 144775685) has the molecular formula C54H36N4 and a molecular weight of 740.91 g/mol. Its IUPAC name is 4-[3-[3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]isoquinoline.
| Compound Name | 4-[3-[3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]isoquinoline |
|---|---|
| PubChem CID | 144775685 |
| Molecular Formula | C54H36N4 |
| Molecular Weight | 740.91 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | 4-[3-[3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]isoquinoline |
| SMILES | C=Cc1c(C=C)c2cccc(-c3cc(-c4cccc(-c5cncc6ccccc56)c4)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2c2ccccc12 |
| InChI | InChI=1S/C54H36N4/c1-3-43-44(4-2)48-28-16-27-46(51(48)49-26-14-13-25-47(43)49)41-30-40(37-22-15-23-38(29-37)50-34-55-33-39-21-11-12-24-45(39)50)31-42(32-41)54-57-52(35-17-7-5-8-18-35)56-53(58-54)36-19-9-6-10-20-36/h3-34H,1-2H2 |
| InChIKey | WFMZLTPJHVBELD-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.91 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|