C30H19BN4 — CID 140795099
CID 140795099 (PubChem CID 140795099) has the molecular formula C30H19BN4 and a molecular weight of 446.32 g/mol.
| Compound Name | CID 140795099 |
|---|---|
| PubChem CID | 140795099 |
| Molecular Formula | C30H19BN4 |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc(-c2cncc3ccccc23)c1 |
| InChI | InChI=1S/C30H19BN4/c31-25-16-23(27-19-32-18-22-13-7-8-14-26(22)27)15-24(17-25)30-34-28(20-9-3-1-4-10-20)33-29(35-30)21-11-5-2-6-12-21/h1-19H |
| InChIKey | ZCAJBCAOQMWMIE-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|