C48H32N4 — CID 144775626
4-[3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]isoquinoline (PubChem CID 144775626) has the molecular formula C48H32N4 and a molecular weight of 664.81 g/mol. Its IUPAC name is 4-[3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]isoquinoline.
| Compound Name | 4-[3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]isoquinoline |
|---|---|
| PubChem CID | 144775626 |
| Molecular Formula | C48H32N4 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | 4-[3-[9,10-bis(ethenyl)phenanthren-4-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]isoquinoline |
| SMILES | C=Cc1c(C=C)c2cccc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-c4cncc5ccccc45)c3)c2c2ccccc12 |
| InChI | InChI=1S/C48H32N4/c1-3-37-38(4-2)42-25-15-24-40(45(42)43-23-14-13-22-41(37)43)34-26-35(44-30-49-29-33-20-11-12-21-39(33)44)28-36(27-34)48-51-46(31-16-7-5-8-17-31)50-47(52-48)32-18-9-6-10-19-32/h3-30H,1-2H2 |
| InChIKey | CHMDHTVNQBLNAE-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|