C30H25N — CID 145080312
(4Z,6Z)-3-methylidene-13-[(2Z)-penta-2,4-dienyl]-13-phenyl-8-azatetracyclo[10.7.0.02,9.014,19]nonadeca-1(12),2(9),4,6,10,14,16,18-octaene (PubChem CID 145080312) has the molecular formula C30H25N and a molecular weight of 399.54 g/mol. Its IUPAC name is (4Z,6Z)-3-methylidene-13-[(2Z)-penta-2,4-dienyl]-13-phenyl-8-azatetracyclo[10.7.0.02,9.014,19]nonadeca-1(12),2(9),4,6,10,14,16,18-octaene.
| Compound Name | (4Z,6Z)-3-methylidene-13-[(2Z)-penta-2,4-dienyl]-13-phenyl-8-azatetracyclo[10.7.0.02,9.014,19]nonadeca-1(12),2(9),4,6,10,14,16,18-octaene |
|---|---|
| PubChem CID | 145080312 |
| Molecular Formula | C30H25N |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (4Z,6Z)-3-methylidene-13-[(2Z)-penta-2,4-dienyl]-13-phenyl-8-azatetracyclo[10.7.0.02,9.014,19]nonadeca-1(12),2(9),4,6,10,14,16,18-octaene |
| SMILES | C=C/C=C\CC1(c2ccccc2)c2ccccc2-c2c1ccc1c2C(=C)/C=C\C=C/N1 |
| InChI | InChI=1S/C30H25N/c1-3-4-11-20-30(23-14-6-5-7-15-23)25-17-9-8-16-24(25)29-26(30)18-19-27-28(29)22(2)13-10-12-21-31-27/h3-19,21,31H,1-2,20H2/b11-4-,13-10-,21-12- |
| InChIKey | FRZXNXYSHLFYQS-OXBPPJKYSA-N |
| XLogP | 7.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|