C35H43N3 — CID 145085232
benzene-1,2-diamine;(Z)-hex-2-ene;(16Z,18Z)-9,9,14-trimethyl-20-methylidene-15-azatetracyclo[11.7.0.02,10.03,8]icosa-1(13),2(10),3,5,7,11,16,18-octaene (PubChem CID 145085232) has the molecular formula C35H43N3 and a molecular weight of 505.75 g/mol. Its IUPAC name is benzene-1,2-diamine;(Z)-hex-2-ene;(16Z,18Z)-9,9,14-trimethyl-20-methylidene-15-azatetracyclo[11.7.0.02,10.03,8]icosa-1(13),2(10),3,5,7,11,16,18-octaene.
| Compound Name | benzene-1,2-diamine;(Z)-hex-2-ene;(16Z,18Z)-9,9,14-trimethyl-20-methylidene-15-azatetracyclo[11.7.0.02,10.03,8]icosa-1(13),2(10),3,5,7,11,16,18-octaene |
|---|---|
| PubChem CID | 145085232 |
| Molecular Formula | C35H43N3 |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.35 |
| IUPAC Name | benzene-1,2-diamine;(Z)-hex-2-ene;(16Z,18Z)-9,9,14-trimethyl-20-methylidene-15-azatetracyclo[11.7.0.02,10.03,8]icosa-1(13),2(10),3,5,7,11,16,18-octaene |
| SMILES | C/C=C\CCC.C=C1/C=C\C=C/NC(C)c2ccc3c(c21)-c1ccccc1C3(C)C.Nc1ccccc1N |
| InChI | InChI=1S/C23H23N.C6H8N2.C6H12/c1-15-9-7-8-14-24-16(2)17-12-13-20-22(21(15)17)18-10-5-6-11-19(18)23(20,3)4;7-5-3-1-2-4-6(5)8;1-3-5-6-4-2/h5-14,16,24H,1H2,2-4H3;1-4H,7-8H2;3,5H,4,6H2,1-2H3/b9-7-,14-8-;;5-3- |
| InChIKey | UIHCWLFQRKOUNY-PNVBOFFISA-N |
| XLogP | 8.95 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|