C21H19N3 — CID 145442525
N-methylidene-N'-[C-methyl-N-(naphthalen-1-ylmethyl)carbonimidoyl]benzenecarboximidamide (PubChem CID 145442525) has the molecular formula C21H19N3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-methylidene-N'-[C-methyl-N-(naphthalen-1-ylmethyl)carbonimidoyl]benzenecarboximidamide.
| Compound Name | N-methylidene-N'-[C-methyl-N-(naphthalen-1-ylmethyl)carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145442525 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-methylidene-N'-[C-methyl-N-(naphthalen-1-ylmethyl)carbonimidoyl]benzenecarboximidamide |
| SMILES | C=N/C(=N\C(C)=N\Cc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H19N3/c1-16(24-21(22-2)18-10-4-3-5-11-18)23-15-19-13-8-12-17-9-6-7-14-20(17)19/h3-14H,2,15H2,1H3/b23-16+,24-21- |
| InChIKey | IOIAXCAGHLVAPC-TUHQPYOXSA-N |
| XLogP | 4.91 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|