About N'-ethyl-N-methylidenenaphthalene-1-carboximidamide
N'-ethyl-N-methylidenenaphthalene-1-carboximidamide (PubChem CID 145291521) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is N'-ethyl-N-methylidenenaphthalene-1-carboximidamide.
Molecular Properties
| Compound Name | N'-ethyl-N-methylidenenaphthalene-1-carboximidamide |
| PubChem CID | 145291521 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N'-ethyl-N-methylidenenaphthalene-1-carboximidamide |
| SMILES | C=N/C(=N\CC)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H14N2/c1-3-16-14(15-2)13-10-6-8-11-7-4-5-9-12(11)13/h4-10H,2-3H2,1H3/b16-14- |
| InChIKey | NGHAFXONWMJLPG-PEZBUJJGSA-N |
| XLogP | 3.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N-methylidenenaphthalene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N-methylidenenaphthalene-1-carboximidamide?
The IUPAC name of N'-ethyl-N-methylidenenaphthalene-1-carboximidamide (CID 145291521) is N'-ethyl-N-methylidenenaphthalene-1-carboximidamide.
What is the SMILES notation for N'-ethyl-N-methylidenenaphthalene-1-carboximidamide?
The canonical SMILES for N'-ethyl-N-methylidenenaphthalene-1-carboximidamide is C=N/C(=N\CC)c1cccc2ccccc12.
What is the InChIKey of N'-ethyl-N-methylidenenaphthalene-1-carboximidamide?
The InChIKey is NGHAFXONWMJLPG-PEZBUJJGSA-N. The full InChI is InChI=1S/C14H14N2/c1-3-16-14(15-2)13-10-6-8-11-7-4-5-9-12(11)13/h4-10H,2-3H2,1H3/b16-14-.
What are the key properties of N'-ethyl-N-methylidenenaphthalene-1-carboximidamide?
N'-ethyl-N-methylidenenaphthalene-1-carboximidamide has a molecular weight of 210.28 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N-methylidenenaphthalene-1-carboximidamide is sourced from PubChem (CID 145291521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).