About CID 102208465
CID 102208465 (PubChem CID 102208465) has the molecular formula C13H13S2
and a molecular weight of 233.38 g/mol.
Molecular Properties
| Compound Name | CID 102208465 |
| PubChem CID | 102208465 |
| Molecular Formula | C13H13S2 |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | — |
| SMILES | CS[C](SC)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H13S2/c1-14-13(15-2)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,1-2H3 |
| InChIKey | AUIWYWSGNDFULI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 102208465 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102208465?
The IUPAC name of CID 102208465 (CID 102208465) is not available.
What is the SMILES notation for CID 102208465?
The canonical SMILES for CID 102208465 is CS[C](SC)c1cccc2ccccc12.
What is the InChIKey of CID 102208465?
The InChIKey is AUIWYWSGNDFULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13S2/c1-14-13(15-2)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,1-2H3.
What are the key properties of CID 102208465?
CID 102208465 has a molecular weight of 233.38 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102208465 is sourced from PubChem (CID 102208465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).