C21H28 — CID 145339177
1-(1-cyclohexa-1,5-dien-1-ylethenyl)-4-propylbenzene;2-methylprop-1-ene (PubChem CID 145339177) has the molecular formula C21H28 and a molecular weight of 280.46 g/mol. Its IUPAC name is 1-(1-cyclohexa-1,5-dien-1-ylethenyl)-4-propylbenzene;2-methylprop-1-ene.
| Compound Name | 1-(1-cyclohexa-1,5-dien-1-ylethenyl)-4-propylbenzene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145339177 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-(1-cyclohexa-1,5-dien-1-ylethenyl)-4-propylbenzene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(C1=CCCC=C1)c1ccc(CCC)cc1 |
| InChI | InChI=1S/C17H20.C4H8/c1-3-7-15-10-12-17(13-11-15)14(2)16-8-5-4-6-9-16;1-4(2)3/h5,8-13H,2-4,6-7H2,1H3;1H2,2-3H3 |
| InChIKey | LZLIPTMCWLPOHY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|