C28H44 — CID 143141723
2-(1-cyclohexa-1,5-dien-1-ylethenyl)-4-ethyl-1-methylbenzene;ethane;(Z)-3-methyloct-2-ene (PubChem CID 143141723) has the molecular formula C28H44 and a molecular weight of 380.66 g/mol. Its IUPAC name is 2-(1-cyclohexa-1,5-dien-1-ylethenyl)-4-ethyl-1-methylbenzene;ethane;(Z)-3-methyloct-2-ene.
| Compound Name | 2-(1-cyclohexa-1,5-dien-1-ylethenyl)-4-ethyl-1-methylbenzene;ethane;(Z)-3-methyloct-2-ene |
|---|---|
| PubChem CID | 143141723 |
| Molecular Formula | C28H44 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | 2-(1-cyclohexa-1,5-dien-1-ylethenyl)-4-ethyl-1-methylbenzene;ethane;(Z)-3-methyloct-2-ene |
| SMILES | C/C=C(/C)CCCCC.C=C(C1=CCCC=C1)c1cc(CC)ccc1C.CC |
| InChI | InChI=1S/C17H20.C9H18.C2H6/c1-4-15-11-10-13(2)17(12-15)14(3)16-8-6-5-7-9-16;1-4-6-7-8-9(3)5-2;1-2/h6,8-12H,3-5,7H2,1-2H3;5H,4,6-8H2,1-3H3;1-2H3/b;9-5-; |
| InChIKey | BTCBIVJSMWVTQS-PJDKWVILSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|