C37H47N — CID 142933779
N-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]-2-methyl-1-[4-[2-(4-prop-1-en-2-ylphenyl)ethyl]phenyl]octan-3-imine (PubChem CID 142933779) has the molecular formula C37H47N and a molecular weight of 505.79 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]-2-methyl-1-[4-[2-(4-prop-1-en-2-ylphenyl)ethyl]phenyl]octan-3-imine.
| Compound Name | N-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]-2-methyl-1-[4-[2-(4-prop-1-en-2-ylphenyl)ethyl]phenyl]octan-3-imine |
|---|---|
| PubChem CID | 142933779 |
| Molecular Formula | C37H47N |
| Molecular Weight | 505.79 g/mol |
| Exact Mass | 505.37 |
| IUPAC Name | N-[(Z)-1-(2,4-dimethylphenyl)prop-1-enyl]-2-methyl-1-[4-[2-(4-prop-1-en-2-ylphenyl)ethyl]phenyl]octan-3-imine |
| SMILES | C=C(C)c1ccc(CCc2ccc(CC(C)/C(CCCCC)=N/C(=C\C)c3ccc(C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C37H47N/c1-8-10-11-12-37(38-36(9-2)35-24-13-28(5)25-29(35)6)30(7)26-33-18-16-31(17-19-33)14-15-32-20-22-34(23-21-32)27(3)4/h9,13,16-25,30H,3,8,10-12,14-15,26H2,1-2,4-7H3/b36-9-,38-37+ |
| InChIKey | KKOHMIHJLLRFJL-KYFLSQMSSA-N |
| XLogP | 10.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.79 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|