C18H23NO — CID 143097022
4-[(1E,3E,7Z)-6-methyl-7-propylcycloocta-1,3,7-trien-1-yl]oxyaniline (PubChem CID 143097022) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-[(1E,3E,7Z)-6-methyl-7-propylcycloocta-1,3,7-trien-1-yl]oxyaniline.
| Compound Name | 4-[(1E,3E,7Z)-6-methyl-7-propylcycloocta-1,3,7-trien-1-yl]oxyaniline |
|---|---|
| PubChem CID | 143097022 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 4-[(1E,3E,7Z)-6-methyl-7-propylcycloocta-1,3,7-trien-1-yl]oxyaniline |
| SMILES | CCC/C1=C/C(Oc2ccc(N)cc2)=C\C=C/CC1C |
| InChI | InChI=1S/C18H23NO/c1-3-6-15-13-18(8-5-4-7-14(15)2)20-17-11-9-16(19)10-12-17/h4-5,8-14H,3,6-7,19H2,1-2H3/b5-4-,15-13-,18-8+ |
| InChIKey | UQXKLHZWRXQALL-REPFNYNKSA-N |
| XLogP | 4.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|