C34H38N2O2 — CID 70291666
4-[4-[1-[4-(4-aminophenoxy)phenyl]-1-cyclohexylbutyl]phenoxy]aniline (PubChem CID 70291666) has the molecular formula C34H38N2O2 and a molecular weight of 506.69 g/mol. Its IUPAC name is 4-[4-[1-[4-(4-aminophenoxy)phenyl]-1-cyclohexylbutyl]phenoxy]aniline.
| Compound Name | 4-[4-[1-[4-(4-aminophenoxy)phenyl]-1-cyclohexylbutyl]phenoxy]aniline |
|---|---|
| PubChem CID | 70291666 |
| Molecular Formula | C34H38N2O2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 4-[4-[1-[4-(4-aminophenoxy)phenyl]-1-cyclohexylbutyl]phenoxy]aniline |
| SMILES | CCCC(c1ccc(Oc2ccc(N)cc2)cc1)(c1ccc(Oc2ccc(N)cc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C34H38N2O2/c1-2-24-34(25-6-4-3-5-7-25,26-8-16-30(17-9-26)37-32-20-12-28(35)13-21-32)27-10-18-31(19-11-27)38-33-22-14-29(36)15-23-33/h8-23,25H,2-7,24,35-36H2,1H3 |
| InChIKey | JYOXJAHRDKOOAY-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|