C12H13NO — CID 129019348
4-cyclohexa-1,3-dien-1-yloxyaniline (PubChem CID 129019348) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yloxyaniline.
| Compound Name | 4-cyclohexa-1,3-dien-1-yloxyaniline |
|---|---|
| PubChem CID | 129019348 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yloxyaniline |
| SMILES | Nc1ccc(OC2=CC=CCC2)cc1 |
| InChI | InChI=1S/C12H13NO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-2,4,6-9H,3,5,13H2 |
| InChIKey | NGCWDPAEARIVDL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|