C12H16N2O2 — CID 163469996
2-amino-3-(5-methyl-3a,4-dihydro-1H-indol-3-yl)propanoic acid (PubChem CID 163469996) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-amino-3-(5-methyl-3a,4-dihydro-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(5-methyl-3a,4-dihydro-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 163469996 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-amino-3-(5-methyl-3a,4-dihydro-1H-indol-3-yl)propanoic acid |
| SMILES | CC1=CC=C2NC=C(CC(N)C(=O)O)C2C1 |
| InChI | InChI=1S/C12H16N2O2/c1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16/h2-3,6,9-10,14H,4-5,13H2,1H3,(H,15,16) |
| InChIKey | BVTXZOCDGOIQNM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |