C10H15Cl — CID 166712660
6-chloro-1-(2-methylpropyl)cyclohexa-1,3-diene (PubChem CID 166712660) has the molecular formula C10H15Cl and a molecular weight of 170.68 g/mol. Its IUPAC name is 6-chloro-1-(2-methylpropyl)cyclohexa-1,3-diene.
| Compound Name | 6-chloro-1-(2-methylpropyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 166712660 |
| Molecular Formula | C10H15Cl |
| Molecular Weight | 170.68 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 6-chloro-1-(2-methylpropyl)cyclohexa-1,3-diene |
| SMILES | CC(C)CC1=CC=CCC1Cl |
| InChI | InChI=1S/C10H15Cl/c1-8(2)7-9-5-3-4-6-10(9)11/h3-5,8,10H,6-7H2,1-2H3 |
| InChIKey | BQGGWYSVDNLDEJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|