C18H19NO4 — CID 174784306
4-(3,4,4a,5-tetrahydro-1H-isoquinoline-2-carbonyl)-4-formylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 174784306) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-(3,4,4a,5-tetrahydro-1H-isoquinoline-2-carbonyl)-4-formylcyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-(3,4,4a,5-tetrahydro-1H-isoquinoline-2-carbonyl)-4-formylcyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 174784306 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-(3,4,4a,5-tetrahydro-1H-isoquinoline-2-carbonyl)-4-formylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | O=CC1(C(=O)N2CCC3CC=CC=C3C2)C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C18H19NO4/c20-12-18(8-5-14(6-9-18)16(21)22)17(23)19-10-7-13-3-1-2-4-15(13)11-19/h1-2,4-6,8,12-13H,3,7,9-11H2,(H,21,22) |
| InChIKey | CFWFNSJJZAQIHO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|