About 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid
1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid (PubChem CID 154430045) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid.
Analyze 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid?
The IUPAC name of 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid (CID 154430045) is 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid.
What is the SMILES notation for 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid?
The canonical SMILES for 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid is O=C(O)C1CCC2CC=CC=C2N1O.
What is the InChIKey of 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid?
The InChIKey is HZNPPKJDUVUGLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c12-10(13)9-6-5-7-3-1-2-4-8(7)11(9)14/h1-2,4,7,9,14H,3,5-6H2,(H,12,13).
What are the key properties of 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid?
1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid has a molecular weight of 195.22 g/mol, XLogP of 1.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,4,4a,5-tetrahydro-2H-quinoline-2-carboxylic acid is sourced from PubChem (CID 154430045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).