C11H14ClNO — CID 70604856
1-(3,4,4a,5-tetrahydro-2H-quinolin-1-yl)-2-chloroethanone (PubChem CID 70604856) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 1-(3,4,4a,5-tetrahydro-2H-quinolin-1-yl)-2-chloroethanone.
| Compound Name | 1-(3,4,4a,5-tetrahydro-2H-quinolin-1-yl)-2-chloroethanone |
|---|---|
| PubChem CID | 70604856 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(3,4,4a,5-tetrahydro-2H-quinolin-1-yl)-2-chloroethanone |
| SMILES | O=C(CCl)N1CCCC2CC=CC=C21 |
| InChI | InChI=1S/C11H14ClNO/c12-8-11(14)13-7-3-5-9-4-1-2-6-10(9)13/h1-2,6,9H,3-5,7-8H2 |
| InChIKey | AACPXALUMMCZFO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|