C11H16ClNO — CID 66794369
1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-2-chloroethanone (PubChem CID 66794369) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-2-chloroethanone.
| Compound Name | 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-2-chloroethanone |
|---|---|
| PubChem CID | 66794369 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-2-chloroethanone |
| SMILES | O=C(CCl)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C11H16ClNO/c12-8-11(14)13-7-3-5-9-4-1-2-6-10(9)13/h6,9H,1-5,7-8H2 |
| InChIKey | BHIPCMAJNKORGD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|