About 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone
1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone (PubChem CID 68573045) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone.
Analyze 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone?
The IUPAC name of 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone (CID 68573045) is 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone.
What is the SMILES notation for 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone?
The canonical SMILES for 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone is CC(=O)N1CCCC2CCCC=C21.
What is the InChIKey of 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone?
The InChIKey is PXOWEDPAQNEWDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-9(13)12-8-4-6-10-5-2-3-7-11(10)12/h7,10H,2-6,8H2,1H3.
What are the key properties of 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone?
1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone has a molecular weight of 179.26 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethanone is sourced from PubChem (CID 68573045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).