C18H22N2OS — CID 68684179
3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(cyclopenten-1-yl)-1,3-thiazol-4-yl]methanone (PubChem CID 68684179) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(cyclopenten-1-yl)-1,3-thiazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(cyclopenten-1-yl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 68684179 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(cyclopenten-1-yl)-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(C2=CCCC2)n1)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C18H22N2OS/c21-18(15-12-22-17(19-15)14-7-1-2-8-14)20-11-5-9-13-6-3-4-10-16(13)20/h7,10,12-13H,1-6,8-9,11H2 |
| InChIKey | MIWDSOWCLFLDRS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |