C21H23ClN2O3S — CID 68684537
(4-chloro-3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 68684537) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is (4-chloro-3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | (4-chloro-3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 68684537 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (4-chloro-3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | COc1cccc(-c2nc(C(=O)N3CCC(Cl)C4CCCC=C43)cs2)c1OC |
| InChI | InChI=1S/C21H23ClN2O3S/c1-26-18-9-5-7-14(19(18)27-2)20-23-16(12-28-20)21(25)24-11-10-15(22)13-6-3-4-8-17(13)24/h5,7-9,12-13,15H,3-4,6,10-11H2,1-2H3 |
| InChIKey | REWYMFFMVMDRIN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|