C20H22N2O2S — CID 174558780
3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-[2-(hydroxymethyl)phenyl]-1,3-thiazol-4-yl]methanone (PubChem CID 174558780) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-[2-(hydroxymethyl)phenyl]-1,3-thiazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-[2-(hydroxymethyl)phenyl]-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 174558780 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-[2-(hydroxymethyl)phenyl]-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(-c2ccccc2CO)n1)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C20H22N2O2S/c23-12-15-7-1-3-9-16(15)19-21-17(13-25-19)20(24)22-11-5-8-14-6-2-4-10-18(14)22/h1,3,7,9-10,13-14,23H,2,4-6,8,11-12H2 |
| InChIKey | NGASFEIZUXUYNP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |