C19H19FN2OS — CID 66849936
3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[5-(2-fluoro-4-pyridinyl)thiophen-3-yl]methanone (PubChem CID 66849936) has the molecular formula C19H19FN2OS and a molecular weight of 342.44 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[5-(2-fluoro-4-pyridinyl)thiophen-3-yl]methanone.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[5-(2-fluoro-4-pyridinyl)thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 66849936 |
| Molecular Formula | C19H19FN2OS |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[5-(2-fluoro-4-pyridinyl)thiophen-3-yl]methanone |
| SMILES | O=C(c1csc(-c2ccnc(F)c2)c1)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C19H19FN2OS/c20-18-11-14(7-8-21-18)17-10-15(12-24-17)19(23)22-9-3-5-13-4-1-2-6-16(13)22/h6-8,10-13H,1-5,9H2 |
| InChIKey | GNBDJALDAYSTQY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|