C29H27N3O3S2 — CID 69267168
3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-(2-phenyl-1,3-thiazol-4-yl)methanone;2-phenyl-1,3-thiazole-4-carboxylic acid (PubChem CID 69267168) has the molecular formula C29H27N3O3S2 and a molecular weight of 529.69 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-(2-phenyl-1,3-thiazol-4-yl)methanone;2-phenyl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-(2-phenyl-1,3-thiazol-4-yl)methanone;2-phenyl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 69267168 |
| Molecular Formula | C29H27N3O3S2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-(2-phenyl-1,3-thiazol-4-yl)methanone;2-phenyl-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2ccccc2)n1.O=C(c1csc(-c2ccccc2)n1)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C19H20N2OS.C10H7NO2S/c22-19(21-12-6-10-14-7-4-5-11-17(14)21)16-13-23-18(20-16)15-8-2-1-3-9-15;12-10(13)8-6-14-9(11-8)7-4-2-1-3-5-7/h1-3,8-9,11,13-14H,4-7,10,12H2;1-6H,(H,12,13) |
| InChIKey | KXHPCZQLXZHBIA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |