C26H26N2O2S — CID 68681549
3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(3-phenylmethoxyphenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 68681549) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(3-phenylmethoxyphenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(3-phenylmethoxyphenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 68681549 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(3-phenylmethoxyphenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(-c2cccc(OCc3ccccc3)c2)n1)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C26H26N2O2S/c29-26(28-15-7-12-20-10-4-5-14-24(20)28)23-18-31-25(27-23)21-11-6-13-22(16-21)30-17-19-8-2-1-3-9-19/h1-3,6,8-9,11,13-14,16,18,20H,4-5,7,10,12,15,17H2 |
| InChIKey | AJWPFYAUBQMMED-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |