C20H19F3N2OS — CID 87539757
3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(2,3,5-trifluoro-4-methylphenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 87539757) has the molecular formula C20H19F3N2OS and a molecular weight of 392.45 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(2,3,5-trifluoro-4-methylphenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(2,3,5-trifluoro-4-methylphenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 87539757 |
| Molecular Formula | C20H19F3N2OS |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl-[2-(2,3,5-trifluoro-4-methylphenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | Cc1c(F)cc(-c2nc(C(=O)N3CCCC4CCCC=C43)cs2)c(F)c1F |
| InChI | InChI=1S/C20H19F3N2OS/c1-11-14(21)9-13(18(23)17(11)22)19-24-15(10-27-19)20(26)25-8-4-6-12-5-2-3-7-16(12)25/h7,9-10,12H,2-6,8H2,1H3 |
| InChIKey | ONAHPTDCSIYZNZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|