C21H22N2O2S — CID 68683050
1-[2-[4-(3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carbonyl)-1,3-thiazol-2-yl]phenyl]ethanone (PubChem CID 68683050) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-[2-[4-(3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carbonyl)-1,3-thiazol-2-yl]phenyl]ethanone.
| Compound Name | 1-[2-[4-(3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carbonyl)-1,3-thiazol-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 68683050 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-[2-[4-(3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carbonyl)-1,3-thiazol-2-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-c1nc(C(=O)N2CCC3CCCC=C3C2)cs1 |
| InChI | InChI=1S/C21H22N2O2S/c1-14(24)17-8-4-5-9-18(17)20-22-19(13-26-20)21(25)23-11-10-15-6-2-3-7-16(15)12-23/h4-5,7-9,13,15H,2-3,6,10-12H2,1H3 |
| InChIKey | TXGSFEAUZCDQNO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|