C20H28N2O2 — CID 66794672
1,2-bis(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethane-1,2-dione (PubChem CID 66794672) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1,2-bis(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 66794672 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1,2-bis(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCC2CCCC=C21)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C20H28N2O2/c23-19(21-13-5-9-15-7-1-3-11-17(15)21)20(24)22-14-6-10-16-8-2-4-12-18(16)22/h11-12,15-16H,1-10,13-14H2 |
| InChIKey | WBGBZUNETAWBJO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|