C17H19ClN2O2 — CID 68835701
2-(3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbonyl)-5-chlorobenzamide (PubChem CID 68835701) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbonyl)-5-chlorobenzamide.
| Compound Name | 2-(3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbonyl)-5-chlorobenzamide |
|---|---|
| PubChem CID | 68835701 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-(3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbonyl)-5-chlorobenzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1C(=O)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C17H19ClN2O2/c18-12-7-8-13(14(10-12)16(19)21)17(22)20-9-3-5-11-4-1-2-6-15(11)20/h6-8,10-11H,1-5,9H2,(H2,19,21) |
| InChIKey | DFLMMJOAVJJBJM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |