C11H9Cl2NO2 — CID 15614171
1-(2,4-dichlorobenzoyl)pyrrolidin-2-one (PubChem CID 15614171) has the molecular formula C11H9Cl2NO2 and a molecular weight of 258.10 g/mol. Its IUPAC name is 1-(2,4-dichlorobenzoyl)pyrrolidin-2-one.
| Compound Name | 1-(2,4-dichlorobenzoyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 15614171 |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 1-(2,4-dichlorobenzoyl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2NO2/c12-7-3-4-8(9(13)6-7)11(16)14-5-1-2-10(14)15/h3-4,6H,1-2,5H2 |
| InChIKey | REMHEFNIMRYCNC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|