C10H8Cl2N2O2 — CID 106993470
1-(2,6-dichloropyridine-3-carbonyl)pyrrolidin-2-one (PubChem CID 106993470) has the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. Its IUPAC name is 1-(2,6-dichloropyridine-3-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(2,6-dichloropyridine-3-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 106993470 |
| Molecular Formula | C10H8Cl2N2O2 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 1-(2,6-dichloropyridine-3-carbonyl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1C(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C10H8Cl2N2O2/c11-7-4-3-6(9(12)13-7)10(16)14-5-1-2-8(14)15/h3-4H,1-2,5H2 |
| InChIKey | WAFCYMGFVHHEAG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|