C16H10Cl2FNO2 — CID 10520959
1-(2,4-dichlorobenzoyl)-7-fluoro-2,3-dihydroquinolin-4-one (PubChem CID 10520959) has the molecular formula C16H10Cl2FNO2 and a molecular weight of 338.17 g/mol. Its IUPAC name is 1-(2,4-dichlorobenzoyl)-7-fluoro-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(2,4-dichlorobenzoyl)-7-fluoro-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 10520959 |
| Molecular Formula | C16H10Cl2FNO2 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 1-(2,4-dichlorobenzoyl)-7-fluoro-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)c2ccc(Cl)cc2Cl)c2cc(F)ccc21 |
| InChI | InChI=1S/C16H10Cl2FNO2/c17-9-1-3-11(13(18)7-9)16(22)20-6-5-15(21)12-4-2-10(19)8-14(12)20/h1-4,7-8H,5-6H2 |
| InChIKey | IZYYFRKFNVHNNI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |