C16H9ClF3NO2 — CID 110406498
6-chloro-1-(2,3,4-trifluorobenzoyl)-2,3-dihydroquinolin-4-one (PubChem CID 110406498) has the molecular formula C16H9ClF3NO2 and a molecular weight of 339.70 g/mol. Its IUPAC name is 6-chloro-1-(2,3,4-trifluorobenzoyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 6-chloro-1-(2,3,4-trifluorobenzoyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110406498 |
| Molecular Formula | C16H9ClF3NO2 |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 6-chloro-1-(2,3,4-trifluorobenzoyl)-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)c2ccc(F)c(F)c2F)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H9ClF3NO2/c17-8-1-4-12-10(7-8)13(22)5-6-21(12)16(23)9-2-3-11(18)15(20)14(9)19/h1-4,7H,5-6H2 |
| InChIKey | JETWGLIVPZQVJE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|