C19H15ClN2O6 — CID 142567396
methyl 2-(7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carbonyl)-5-nitrobenzoate (PubChem CID 142567396) has the molecular formula C19H15ClN2O6 and a molecular weight of 402.79 g/mol. Its IUPAC name is methyl 2-(7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carbonyl)-5-nitrobenzoate.
| Compound Name | methyl 2-(7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carbonyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 142567396 |
| Molecular Formula | C19H15ClN2O6 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | methyl 2-(7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carbonyl)-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1C(=O)N1CCCC(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H15ClN2O6/c1-28-19(25)14-10-12(22(26)27)5-6-13(14)18(24)21-8-2-3-17(23)15-9-11(20)4-7-16(15)21/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | CMIAZHZUQPFGLR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|