C17H12ClF3N2O4 — CID 55671446
(2-chloro-5-nitrophenyl)-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]methanone (PubChem CID 55671446) has the molecular formula C17H12ClF3N2O4 and a molecular weight of 400.74 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]methanone.
| Compound Name | (2-chloro-5-nitrophenyl)-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]methanone |
|---|---|
| PubChem CID | 55671446 |
| Molecular Formula | C17H12ClF3N2O4 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (2-chloro-5-nitrophenyl)-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinolin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1Cl)N1CCCc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H12ClF3N2O4/c18-14-5-3-11(23(25)26)9-13(14)16(24)22-7-1-2-10-8-12(4-6-15(10)22)27-17(19,20)21/h3-6,8-9H,1-2,7H2 |
| InChIKey | KHBTXNSUBCKFKA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|