C20H17F3N2O6 — CID 55671779
ethyl 3-nitro-5-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinoline-1-carbonyl]benzoate (PubChem CID 55671779) has the molecular formula C20H17F3N2O6 and a molecular weight of 438.36 g/mol. Its IUPAC name is ethyl 3-nitro-5-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinoline-1-carbonyl]benzoate.
| Compound Name | ethyl 3-nitro-5-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinoline-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 55671779 |
| Molecular Formula | C20H17F3N2O6 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | ethyl 3-nitro-5-[6-(trifluoromethoxy)-3,4-dihydro-2H-quinoline-1-carbonyl]benzoate |
| SMILES | CCOC(=O)c1cc(C(=O)N2CCCc3cc(OC(F)(F)F)ccc32)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17F3N2O6/c1-2-30-19(27)14-8-13(9-15(10-14)25(28)29)18(26)24-7-3-4-12-11-16(5-6-17(12)24)31-20(21,22)23/h5-6,8-11H,2-4,7H2,1H3 |
| InChIKey | LQOPSBJQXWZUFY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|