C17H15Cl3N2O5S — CID 88518331
[(4E)-6-chloro-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2,4-dichlorophenyl)methanone;methanesulfonic acid (PubChem CID 88518331) has the molecular formula C17H15Cl3N2O5S and a molecular weight of 465.74 g/mol. Its IUPAC name is [(4E)-6-chloro-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2,4-dichlorophenyl)methanone;methanesulfonic acid.
| Compound Name | [(4E)-6-chloro-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2,4-dichlorophenyl)methanone;methanesulfonic acid |
|---|---|
| PubChem CID | 88518331 |
| Molecular Formula | C17H15Cl3N2O5S |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | [(4E)-6-chloro-4-hydroxyimino-2,3-dihydroquinolin-1-yl]-(2,4-dichlorophenyl)methanone;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(c1ccc(Cl)cc1Cl)N1CC/C(=N\O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H11Cl3N2O2.CH4O3S/c17-9-2-4-15-12(7-9)14(20-23)5-6-21(15)16(22)11-3-1-10(18)8-13(11)19;1-5(2,3)4/h1-4,7-8,23H,5-6H2;1H3,(H,2,3,4)/b20-14+; |
| InChIKey | CSRZTYAIOLGCAN-RANVTSCRSA-N |
| XLogP | 4.38 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|