C8H14N2 — CID 154199633
2,3,3a,4,5,6-hexahydroindol-1-amine (PubChem CID 154199633) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydroindol-1-amine.
| Compound Name | 2,3,3a,4,5,6-hexahydroindol-1-amine |
|---|---|
| PubChem CID | 154199633 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2,3,3a,4,5,6-hexahydroindol-1-amine |
| SMILES | NN1CCC2CCCC=C21 |
| InChI | InChI=1S/C8H14N2/c9-10-6-5-7-3-1-2-4-8(7)10/h4,7H,1-3,5-6,9H2 |
| InChIKey | AVAUIJDGZCPXKY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|