C22H31N3O2 — CID 66795109
1-[5-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-benzylurea (PubChem CID 66795109) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[5-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-benzylurea.
| Compound Name | 1-[5-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-benzylurea |
|---|---|
| PubChem CID | 66795109 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 1-[5-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-5-oxopentyl]-3-benzylurea |
| SMILES | O=C(NCCCCC(=O)N1CCCC2CCCC=C21)NCc1ccccc1 |
| InChI | InChI=1S/C22H31N3O2/c26-21(25-16-8-12-19-11-4-5-13-20(19)25)14-6-7-15-23-22(27)24-17-18-9-2-1-3-10-18/h1-3,9-10,13,19H,4-8,11-12,14-17H2,(H2,23,24,27) |
| InChIKey | HKNYEMLORCOAJL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|