C24H33N3O3 — CID 123948744
5-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-N-(2-amino-2-oxoethyl)-5-oxo-N-(2-phenylethyl)pentanamide (PubChem CID 123948744) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 5-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-N-(2-amino-2-oxoethyl)-5-oxo-N-(2-phenylethyl)pentanamide.
| Compound Name | 5-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-N-(2-amino-2-oxoethyl)-5-oxo-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 123948744 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 5-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-N-(2-amino-2-oxoethyl)-5-oxo-N-(2-phenylethyl)pentanamide |
| SMILES | NC(=O)CN(CCc1ccccc1)C(=O)CCCC(=O)N1CCCC2CCCC=C21 |
| InChI | InChI=1S/C24H33N3O3/c25-22(28)18-26(17-15-19-8-2-1-3-9-19)23(29)13-6-14-24(30)27-16-7-11-20-10-4-5-12-21(20)27/h1-3,8-9,12,20H,4-7,10-11,13-18H2,(H2,25,28) |
| InChIKey | BOYUBPHZOHPVAH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |