C23H33N3O3S — CID 66794709
1-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-3-(4-thiophen-2-yloxan-4-yl)urea (PubChem CID 66794709) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 1-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-3-(4-thiophen-2-yloxan-4-yl)urea.
| Compound Name | 1-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-3-(4-thiophen-2-yloxan-4-yl)urea |
|---|---|
| PubChem CID | 66794709 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-[4-(3,4,4a,5,6,7-hexahydro-2H-quinolin-1-yl)-4-oxobutyl]-3-(4-thiophen-2-yloxan-4-yl)urea |
| SMILES | O=C(NCCCC(=O)N1CCCC2CCCC=C21)NC1(c2cccs2)CCOCC1 |
| InChI | InChI=1S/C23H33N3O3S/c27-21(26-14-4-7-18-6-1-2-8-19(18)26)10-3-13-24-22(28)25-23(11-15-29-16-12-23)20-9-5-17-30-20/h5,8-9,17-18H,1-4,6-7,10-16H2,(H2,24,25,28) |
| InChIKey | JGFZOYADWSPEER-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|