C12H15FN2O4 — CID 67903990
(5S)-5-[(6-fluoro-2H-pyridin-1-yl)methyl]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 67903990) has the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. Its IUPAC name is (5S)-5-[(6-fluoro-2H-pyridin-1-yl)methyl]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (5S)-5-[(6-fluoro-2H-pyridin-1-yl)methyl]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67903990 |
| Molecular Formula | C12H15FN2O4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (5S)-5-[(6-fluoro-2H-pyridin-1-yl)methyl]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CC[C@@H](CN2CC=CC=C2F)N1C(=O)O |
| InChI | InChI=1S/C12H15FN2O4/c13-10-3-1-2-6-14(10)7-8-4-5-9(11(16)17)15(8)12(18)19/h1-3,8-9H,4-7H2,(H,16,17)(H,18,19)/t8-,9?/m0/s1 |
| InChIKey | LLYSQJCBCIUMTN-IENPIDJESA-N |
| XLogP | 1.26 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|