C15H16ClN — CID 141386590
2-(4-chlorophenyl)-3,4,4a,5-tetrahydro-1H-isoquinoline (PubChem CID 141386590) has the molecular formula C15H16ClN and a molecular weight of 245.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,4,4a,5-tetrahydro-1H-isoquinoline.
| Compound Name | 2-(4-chlorophenyl)-3,4,4a,5-tetrahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 141386590 |
| Molecular Formula | C15H16ClN |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-(4-chlorophenyl)-3,4,4a,5-tetrahydro-1H-isoquinoline |
| SMILES | Clc1ccc(N2CCC3CC=CC=C3C2)cc1 |
| InChI | InChI=1S/C15H16ClN/c16-14-5-7-15(8-6-14)17-10-9-12-3-1-2-4-13(12)11-17/h1-2,4-8,12H,3,9-11H2 |
| InChIKey | NOJZAPPYYLAMOP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |